About ethyl 2-propan-2-yloxyacetate
ethyl 2-propan-2-yloxyacetate (PubChem CID 537908) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is ethyl 2-propan-2-yloxyacetate.
Molecular Properties
| Compound Name | ethyl 2-propan-2-yloxyacetate |
| PubChem CID | 537908 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | ethyl 2-propan-2-yloxyacetate |
| SMILES | CCOC(=O)COC(C)C |
| InChI | InChI=1S/C7H14O3/c1-4-9-7(8)5-10-6(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | JECQALZMHMNOLO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-propan-2-yloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-propan-2-yloxyacetate?
The IUPAC name of ethyl 2-propan-2-yloxyacetate (CID 537908) is ethyl 2-propan-2-yloxyacetate.
What is the SMILES notation for ethyl 2-propan-2-yloxyacetate?
The canonical SMILES for ethyl 2-propan-2-yloxyacetate is CCOC(=O)COC(C)C.
What is the InChIKey of ethyl 2-propan-2-yloxyacetate?
The InChIKey is JECQALZMHMNOLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3/c1-4-9-7(8)5-10-6(2)3/h6H,4-5H2,1-3H3.
What are the key properties of ethyl 2-propan-2-yloxyacetate?
ethyl 2-propan-2-yloxyacetate has a molecular weight of 146.19 g/mol, XLogP of 0.97, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-propan-2-yloxyacetate is sourced from PubChem (CID 537908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).