C12H24N2O3 — CID 18003347
1,4-bis(2-hydroxyethyl)-3,3,5,5-tetramethylpiperazin-2-one (PubChem CID 18003347) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1,4-bis(2-hydroxyethyl)-3,3,5,5-tetramethylpiperazin-2-one.
| Compound Name | 1,4-bis(2-hydroxyethyl)-3,3,5,5-tetramethylpiperazin-2-one |
|---|---|
| PubChem CID | 18003347 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1,4-bis(2-hydroxyethyl)-3,3,5,5-tetramethylpiperazin-2-one |
| SMILES | CC1(C)CN(CCO)C(=O)C(C)(C)N1CCO |
| InChI | InChI=1S/C12H24N2O3/c1-11(2)9-13(5-7-15)10(17)12(3,4)14(11)6-8-16/h15-16H,5-9H2,1-4H3 |
| InChIKey | ILYSENRAZISKGY-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |