About 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione
5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione (PubChem CID 69251235) has the molecular formula C8H16N2O5Si
and a molecular weight of 248.31 g/mol. Its IUPAC name is 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione |
| PubChem CID | 69251235 |
| Molecular Formula | C8H16N2O5Si |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione |
| SMILES | CCC(N1C(=O)NC(C)(C)C1=O)[Si](O)(O)O |
| InChI | InChI=1S/C8H16N2O5Si/c1-4-5(16(13,14)15)10-6(11)8(2,3)9-7(10)12/h5,13-15H,4H2,1-3H3,(H,9,12) |
| InChIKey | MYWYAAKRVWVNRL-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione?
The IUPAC name of 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione (CID 69251235) is 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione?
The canonical SMILES for 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione is CCC(N1C(=O)NC(C)(C)C1=O)[Si](O)(O)O.
What is the InChIKey of 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione?
The InChIKey is MYWYAAKRVWVNRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O5Si/c1-4-5(16(13,14)15)10-6(11)8(2,3)9-7(10)12/h5,13-15H,4H2,1-3H3,(H,9,12).
What are the key properties of 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione?
5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione has a molecular weight of 248.31 g/mol, XLogP of -1.45, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione is sourced from PubChem (CID 69251235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).