C8H16N2O5Si — CID 69251235
5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione (PubChem CID 69251235) has the molecular formula C8H16N2O5Si and a molecular weight of 248.31 g/mol. Its IUPAC name is 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 69251235 |
| Molecular Formula | C8H16N2O5Si |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5,5-dimethyl-3-(1-trihydroxysilylpropyl)imidazolidine-2,4-dione |
| SMILES | CCC(N1C(=O)NC(C)(C)C1=O)[Si](O)(O)O |
| InChI | InChI=1S/C8H16N2O5Si/c1-4-5(16(13,14)15)10-6(11)8(2,3)9-7(10)12/h5,13-15H,4H2,1-3H3,(H,9,12) |
| InChIKey | MYWYAAKRVWVNRL-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|