C19H30N2O4 — CID 90853649
(2S)-3-cyclohexyl-2-[(5S)-5-cyclohexyl-5-methyl-2,4-dioxoimidazolidin-1-yl]propanoic acid (PubChem CID 90853649) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-2-[(5S)-5-cyclohexyl-5-methyl-2,4-dioxoimidazolidin-1-yl]propanoic acid.
| Compound Name | (2S)-3-cyclohexyl-2-[(5S)-5-cyclohexyl-5-methyl-2,4-dioxoimidazolidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 90853649 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (2S)-3-cyclohexyl-2-[(5S)-5-cyclohexyl-5-methyl-2,4-dioxoimidazolidin-1-yl]propanoic acid |
| SMILES | C[C@]1(C2CCCCC2)C(=O)NC(=O)N1[C@@H](CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C19H30N2O4/c1-19(14-10-6-3-7-11-14)17(24)20-18(25)21(19)15(16(22)23)12-13-8-4-2-5-9-13/h13-15H,2-12H2,1H3,(H,22,23)(H,20,24,25)/t15-,19-/m0/s1 |
| InChIKey | USRDYNBPOKDBQI-KXBFYZLASA-N |
| XLogP | 3.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|