C16H30N2O2 — CID 64965046
3-ethyl-3,6-dimethyl-1-octan-2-ylpiperazine-2,5-dione (PubChem CID 64965046) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 3-ethyl-3,6-dimethyl-1-octan-2-ylpiperazine-2,5-dione.
| Compound Name | 3-ethyl-3,6-dimethyl-1-octan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64965046 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 3-ethyl-3,6-dimethyl-1-octan-2-ylpiperazine-2,5-dione |
| SMILES | CCCCCCC(C)N1C(=O)C(C)(CC)NC(=O)C1C |
| InChI | InChI=1S/C16H30N2O2/c1-6-8-9-10-11-12(3)18-13(4)14(19)17-16(5,7-2)15(18)20/h12-13H,6-11H2,1-5H3,(H,17,19) |
| InChIKey | FKOKXQWFQINONO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|