C23H45N3O2 — CID 70594895
5-methyl-3-[(nonan-2-ylamino)methyl]-5-nonylimidazolidine-2,4-dione (PubChem CID 70594895) has the molecular formula C23H45N3O2 and a molecular weight of 395.63 g/mol. Its IUPAC name is 5-methyl-3-[(nonan-2-ylamino)methyl]-5-nonylimidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-[(nonan-2-ylamino)methyl]-5-nonylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70594895 |
| Molecular Formula | C23H45N3O2 |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.35 |
| IUPAC Name | 5-methyl-3-[(nonan-2-ylamino)methyl]-5-nonylimidazolidine-2,4-dione |
| SMILES | CCCCCCCCCC1(C)NC(=O)N(CNC(C)CCCCCCC)C1=O |
| InChI | InChI=1S/C23H45N3O2/c1-5-7-9-11-12-14-16-18-23(4)21(27)26(22(28)25-23)19-24-20(3)17-15-13-10-8-6-2/h20,24H,5-19H2,1-4H3,(H,25,28) |
| InChIKey | KTXYMSJQBRYXTI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|