C19H24Cl3N3O3 — CID 42964405
2-(4-heptyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 42964405) has the molecular formula C19H24Cl3N3O3 and a molecular weight of 448.78 g/mol. Its IUPAC name is 2-(4-heptyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-(4-heptyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 42964405 |
| Molecular Formula | C19H24Cl3N3O3 |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 2-(4-heptyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | CCCCCCCC1(C)NC(=O)N(CC(=O)Nc2c(Cl)cc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C19H24Cl3N3O3/c1-3-4-5-6-7-8-19(2)17(27)25(18(28)24-19)11-15(26)23-16-13(21)9-12(20)10-14(16)22/h9-10H,3-8,11H2,1-2H3,(H,23,26)(H,24,28) |
| InChIKey | LBLJODAVHRYENX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|