C20H28BrN3O3 — CID 42964411
N-(2-bromo-4-methylphenyl)-2-(4-heptyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 42964411) has the molecular formula C20H28BrN3O3 and a molecular weight of 438.37 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-(4-heptyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-(4-heptyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 42964411 |
| Molecular Formula | C20H28BrN3O3 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-(4-heptyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCCCCCCC1(C)NC(=O)N(CC(=O)Nc2ccc(C)cc2Br)C1=O |
| InChI | InChI=1S/C20H28BrN3O3/c1-4-5-6-7-8-11-20(3)18(26)24(19(27)23-20)13-17(25)22-16-10-9-14(2)12-15(16)21/h9-10,12H,4-8,11,13H2,1-3H3,(H,22,25)(H,23,27) |
| InChIKey | JXJRGRNVZGSDMG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|