C18H24IN3O3 — CID 4810361
2-(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(3-iodophenyl)acetamide (PubChem CID 4810361) has the molecular formula C18H24IN3O3 and a molecular weight of 457.31 g/mol. Its IUPAC name is 2-(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(3-iodophenyl)acetamide.
| Compound Name | 2-(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 4810361 |
| Molecular Formula | C18H24IN3O3 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(3-iodophenyl)acetamide |
| SMILES | CCCCCCC1(C)NC(=O)N(CC(=O)Nc2cccc(I)c2)C1=O |
| InChI | InChI=1S/C18H24IN3O3/c1-3-4-5-6-10-18(2)16(24)22(17(25)21-18)12-15(23)20-14-9-7-8-13(19)11-14/h7-9,11H,3-6,10,12H2,1-2H3,(H,20,23)(H,21,25) |
| InChIKey | VSTKBIARTCFPII-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|