C19H24F3N3O4 — CID 7916875
2-[(4R)-4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 7916875) has the molecular formula C19H24F3N3O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is 2-[(4R)-4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(4R)-4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 7916875 |
| Molecular Formula | C19H24F3N3O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-[(4R)-4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | CCCCCC[C@@]1(C)NC(=O)N(CC(=O)Nc2ccc(OC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C19H24F3N3O4/c1-3-4-5-6-11-18(2)16(27)25(17(28)24-18)12-15(26)23-13-7-9-14(10-8-13)29-19(20,21)22/h7-10H,3-6,11-12H2,1-2H3,(H,23,26)(H,24,28)/t18-/m1/s1 |
| InChIKey | GFIPWTPQQIOGTJ-GOSISDBHSA-N |
| XLogP | 3.80 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|