C24H29N3O3S — CID 3899651
2-(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 3899651) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 3899651 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 2-(4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | CCCCCCC1(C)NC(=O)N(CC(=O)Nc2ccccc2Sc2ccccc2)C1=O |
| InChI | InChI=1S/C24H29N3O3S/c1-3-4-5-11-16-24(2)22(29)27(23(30)26-24)17-21(28)25-19-14-9-10-15-20(19)31-18-12-7-6-8-13-18/h6-10,12-15H,3-5,11,16-17H2,1-2H3,(H,25,28)(H,26,30) |
| InChIKey | ABRXIUDXAYWILN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|