C6H10N2O3 — CID 126988402
(5R)-3-ethoxy-5-methylimidazolidine-2,4-dione (PubChem CID 126988402) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is (5R)-3-ethoxy-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-ethoxy-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126988402 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | (5R)-3-ethoxy-5-methylimidazolidine-2,4-dione |
| SMILES | CCON1C(=O)N[C@H](C)C1=O |
| InChI | InChI=1S/C6H10N2O3/c1-3-11-8-5(9)4(2)7-6(8)10/h4H,3H2,1-2H3,(H,7,10)/t4-/m1/s1 |
| InChIKey | QOTXOIRZDHREDB-SCSAIBSYSA-N |
| XLogP | -0.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|