C8H12N2O4 — CID 137320526
ethyl 2-(4-methyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 137320526) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is ethyl 2-(4-methyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | ethyl 2-(4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 137320526 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | ethyl 2-(4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)NC(C)C1=O |
| InChI | InChI=1S/C8H12N2O4/c1-3-14-6(11)4-10-7(12)5(2)9-8(10)13/h5H,3-4H2,1-2H3,(H,9,13) |
| InChIKey | SDFTURJYVJYCSW-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|