C22H19NO8 — CID 1020607
[(3R,4R)-4-benzoyloxy-1-(2-ethoxy-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] benzoate (PubChem CID 1020607) has the molecular formula C22H19NO8 and a molecular weight of 425.39 g/mol. Its IUPAC name is [(3R,4R)-4-benzoyloxy-1-(2-ethoxy-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] benzoate.
| Compound Name | [(3R,4R)-4-benzoyloxy-1-(2-ethoxy-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] benzoate |
|---|---|
| PubChem CID | 1020607 |
| Molecular Formula | C22H19NO8 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [(3R,4R)-4-benzoyloxy-1-(2-ethoxy-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] benzoate |
| SMILES | CCOC(=O)CN1C(=O)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C22H19NO8/c1-2-29-16(24)13-23-19(25)17(30-21(27)14-9-5-3-6-10-14)18(20(23)26)31-22(28)15-11-7-4-8-12-15/h3-12,17-18H,2,13H2,1H3/t17-,18-/m1/s1 |
| InChIKey | KZLDWBSCYBHPAW-QZTJIDSGSA-N |
| XLogP | 1.37 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|