C28H19NO6 — CID 126284826
[(3S,4R)-4-benzoyloxy-1-naphthalen-1-yl-2,5-dioxopyrrolidin-3-yl] benzoate (PubChem CID 126284826) has the molecular formula C28H19NO6 and a molecular weight of 465.46 g/mol. Its IUPAC name is [(3S,4R)-4-benzoyloxy-1-naphthalen-1-yl-2,5-dioxopyrrolidin-3-yl] benzoate.
| Compound Name | [(3S,4R)-4-benzoyloxy-1-naphthalen-1-yl-2,5-dioxopyrrolidin-3-yl] benzoate |
|---|---|
| PubChem CID | 126284826 |
| Molecular Formula | C28H19NO6 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | [(3S,4R)-4-benzoyloxy-1-naphthalen-1-yl-2,5-dioxopyrrolidin-3-yl] benzoate |
| SMILES | O=C(O[C@@H]1C(=O)N(c2cccc3ccccc23)C(=O)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H19NO6/c30-25-23(34-27(32)19-11-3-1-4-12-19)24(35-28(33)20-13-5-2-6-14-20)26(31)29(25)22-17-9-15-18-10-7-8-16-21(18)22/h1-17,23-24H/t23-,24+ |
| InChIKey | DPOVMCYZAYFKLW-PSWAGMNNSA-N |
| XLogP | 4.16 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|