C26H21NO7 — CID 126299270
[(3R,4R)-4-benzoyloxy-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] benzoate (PubChem CID 126299270) has the molecular formula C26H21NO7 and a molecular weight of 459.45 g/mol. Its IUPAC name is [(3R,4R)-4-benzoyloxy-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] benzoate.
| Compound Name | [(3R,4R)-4-benzoyloxy-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] benzoate |
|---|---|
| PubChem CID | 126299270 |
| Molecular Formula | C26H21NO7 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [(3R,4R)-4-benzoyloxy-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] benzoate |
| SMILES | CCOc1ccc(N2C(=O)[C@H](OC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H21NO7/c1-2-32-20-15-13-19(14-16-20)27-23(28)21(33-25(30)17-9-5-3-6-10-17)22(24(27)29)34-26(31)18-11-7-4-8-12-18/h3-16,21-22H,2H2,1H3/t21-,22-/m1/s1 |
| InChIKey | HBVRNFOUIVKJJX-FGZHOGPDSA-N |
| XLogP | 3.41 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|