C26H21NO8 — CID 126306160
[(3R,4R)-4-benzoyloxy-1-(2,5-dimethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] benzoate (PubChem CID 126306160) has the molecular formula C26H21NO8 and a molecular weight of 475.45 g/mol. Its IUPAC name is [(3R,4R)-4-benzoyloxy-1-(2,5-dimethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] benzoate.
| Compound Name | [(3R,4R)-4-benzoyloxy-1-(2,5-dimethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] benzoate |
|---|---|
| PubChem CID | 126306160 |
| Molecular Formula | C26H21NO8 |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | [(3R,4R)-4-benzoyloxy-1-(2,5-dimethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] benzoate |
| SMILES | COc1ccc(OC)c(N2C(=O)[C@H](OC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C26H21NO8/c1-32-18-13-14-20(33-2)19(15-18)27-23(28)21(34-25(30)16-9-5-3-6-10-16)22(24(27)29)35-26(31)17-11-7-4-8-12-17/h3-15,21-22H,1-2H3/t21-,22-/m1/s1 |
| InChIKey | WPHBRBVMCDCUTC-FGZHOGPDSA-N |
| XLogP | 3.03 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|