C27H21NO6 — CID 3255463
17-(2,5-dimethoxyphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid (PubChem CID 3255463) has the molecular formula C27H21NO6 and a molecular weight of 455.47 g/mol. Its IUPAC name is 17-(2,5-dimethoxyphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid.
| Compound Name | 17-(2,5-dimethoxyphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid |
|---|---|
| PubChem CID | 3255463 |
| Molecular Formula | C27H21NO6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 17-(2,5-dimethoxyphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid |
| SMILES | COc1ccc(OC)c(N2C(=O)C3C4c5ccccc5C(C(=O)O)(c5ccccc54)C3C2=O)c1 |
| InChI | InChI=1S/C27H21NO6/c1-33-14-11-12-20(34-2)19(13-14)28-24(29)22-21-15-7-3-5-9-17(15)27(26(31)32,23(22)25(28)30)18-10-6-4-8-16(18)21/h3-13,21-23H,1-2H3,(H,31,32) |
| InChIKey | FRVFDVIJPXIPON-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|