C25H17NO4 — CID 3125588
16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid (PubChem CID 3125588) has the molecular formula C25H17NO4 and a molecular weight of 395.41 g/mol. Its IUPAC name is 16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid.
| Compound Name | 16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid |
|---|---|
| PubChem CID | 3125588 |
| Molecular Formula | C25H17NO4 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid |
| SMILES | O=C1C2C3c4ccccc4C(C(=O)O)(c4ccccc43)C2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C25H17NO4/c27-22-20-19-15-10-4-6-12-17(15)25(24(29)30,18-13-7-5-11-16(18)19)21(20)23(28)26(22)14-8-2-1-3-9-14/h1-13,19-21H,(H,29,30) |
| InChIKey | VYIIMDKXZXHOTF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|