C31H29NO5 — CID 27868362
(15S,19R)-17-(4-hexoxyphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid (PubChem CID 27868362) has the molecular formula C31H29NO5 and a molecular weight of 495.58 g/mol. Its IUPAC name is (15S,19R)-17-(4-hexoxyphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid.
| Compound Name | (15S,19R)-17-(4-hexoxyphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid |
|---|---|
| PubChem CID | 27868362 |
| Molecular Formula | C31H29NO5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (15S,19R)-17-(4-hexoxyphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid |
| SMILES | CCCCCCOc1ccc(N2C(=O)[C@@H]3C4c5ccccc5C(C(=O)O)(c5ccccc54)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C31H29NO5/c1-2-3-4-9-18-37-20-16-14-19(15-17-20)32-28(33)26-25-21-10-5-7-12-23(21)31(30(35)36,27(26)29(32)34)24-13-8-6-11-22(24)25/h5-8,10-17,25-27H,2-4,9,18H2,1H3,(H,35,36)/t25?,26-,27-,31?/m1/s1 |
| InChIKey | NJTHHGPXTZRHLG-JDLUJFQQSA-N |
| XLogP | 5.28 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|