About [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate
[(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate (PubChem CID 126309214) has the molecular formula C24H16FNO6
and a molecular weight of 433.39 g/mol. Its IUPAC name is [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate.
Molecular Properties
| Compound Name | [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate |
| PubChem CID | 126309214 |
| Molecular Formula | C24H16FNO6 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate |
| SMILES | O=C(O[C@H]1C(=O)N(c2ccccc2F)C(=O)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H16FNO6/c25-17-13-7-8-14-18(17)26-21(27)19(31-23(29)15-9-3-1-4-10-15)20(22(26)28)32-24(30)16-11-5-2-6-12-16/h1-14,19-20H/t19-,20-/m1/s1 |
| InChIKey | GNYHGMHQQIOVJT-WOJBJXKFSA-N |
| XLogP | 3.15 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate?
The IUPAC name of [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate (CID 126309214) is [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate.
What is the SMILES notation for [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate?
The canonical SMILES for [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate is O=C(O[C@H]1C(=O)N(c2ccccc2F)C(=O)[C@@H]1OC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate?
The InChIKey is GNYHGMHQQIOVJT-WOJBJXKFSA-N. The full InChI is InChI=1S/C24H16FNO6/c25-17-13-7-8-14-18(17)26-21(27)19(31-23(29)15-9-3-1-4-10-15)20(22(26)28)32-24(30)16-11-5-2-6-12-16/h1-14,19-20H/t19-,20-/m1/s1.
What are the key properties of [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate?
[(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate has a molecular weight of 433.39 g/mol, XLogP of 3.15, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-4-benzoyloxy-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] benzoate is sourced from PubChem (CID 126309214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).