C26H20FNO2 — CID 11892286
(3aR,4S,7R,7aR)-2-(2-fluorophenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 11892286) has the molecular formula C26H20FNO2 and a molecular weight of 397.45 g/mol. Its IUPAC name is (3aR,4S,7R,7aR)-2-(2-fluorophenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aR)-2-(2-fluorophenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11892286 |
| Molecular Formula | C26H20FNO2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (3aR,4S,7R,7aR)-2-(2-fluorophenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1c1ccccc1F)[C@H](c1ccccc1)C=C[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C26H20FNO2/c27-21-13-7-8-14-22(21)28-25(29)23-19(17-9-3-1-4-10-17)15-16-20(24(23)26(28)30)18-11-5-2-6-12-18/h1-16,19-20,23-24H/t19-,20+,23-,24-/m1/s1 |
| InChIKey | JVDYPINCEXMGBX-WNXIRNOKSA-N |
| XLogP | 5.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|