C26H21N2O4- — CID 163146425
(3aR,4R,7R,7aS)-2-[2-[hydroxy(oxido)amino]phenyl]-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 163146425) has the molecular formula C26H21N2O4- and a molecular weight of 425.46 g/mol. Its IUPAC name is (3aR,4R,7R,7aS)-2-[2-[hydroxy(oxido)amino]phenyl]-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4R,7R,7aS)-2-[2-[hydroxy(oxido)amino]phenyl]-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 163146425 |
| Molecular Formula | C26H21N2O4- |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (3aR,4R,7R,7aS)-2-[2-[hydroxy(oxido)amino]phenyl]-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccccc1N([O-])O)[C@H](c1ccccc1)C=C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C26H21N2O4/c29-25-23-19(17-9-3-1-4-10-17)15-16-20(18-11-5-2-6-12-18)24(23)26(30)27(25)21-13-7-8-14-22(21)28(31)32/h1-16,19-20,23-24,31H/q-1/t19-,20-,23-,24+/m0/s1 |
| InChIKey | BKBKMCKZJMTGEJ-NVXDSCFRSA-N |
| XLogP | 4.62 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|