C25H17N2O5- — CID 163182983
(15S,19S)-17-[2-[hydroxy(oxido)amino]phenyl]-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde (PubChem CID 163182983) has the molecular formula C25H17N2O5- and a molecular weight of 425.42 g/mol. Its IUPAC name is (15S,19S)-17-[2-[hydroxy(oxido)amino]phenyl]-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde.
| Compound Name | (15S,19S)-17-[2-[hydroxy(oxido)amino]phenyl]-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde |
|---|---|
| PubChem CID | 163182983 |
| Molecular Formula | C25H17N2O5- |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (15S,19S)-17-[2-[hydroxy(oxido)amino]phenyl]-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde |
| SMILES | O=CC12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(c3ccccc3N([O-])O)C(=O)[C@@H]12 |
| InChI | InChI=1S/C25H17N2O5/c28-13-25-16-9-3-1-7-14(16)20(15-8-2-4-10-17(15)25)21-22(25)24(30)26(23(21)29)18-11-5-6-12-19(18)27(31)32/h1-13,20-22,31H/q-1/t20?,21-,22+,25?/m0/s1 |
| InChIKey | FMKGFWAWRFUSBS-ZKKFKWFVSA-N |
| XLogP | 3.13 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|