C28H21NO5 — CID 30398195
ethyl 2-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate (PubChem CID 30398195) has the molecular formula C28H21NO5 and a molecular weight of 451.48 g/mol. Its IUPAC name is ethyl 2-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate.
| Compound Name | ethyl 2-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate |
|---|---|
| PubChem CID | 30398195 |
| Molecular Formula | C28H21NO5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | ethyl 2-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1N1C(=O)[C@@H]2C3c4ccccc4C(C=O)(c4ccccc43)[C@H]2C1=O |
| InChI | InChI=1S/C28H21NO5/c1-2-34-27(33)18-11-5-8-14-21(18)29-25(31)23-22-16-9-3-6-12-19(16)28(15-30,24(23)26(29)32)20-13-7-4-10-17(20)22/h3-15,22-24H,2H2,1H3/t22?,23-,24-,28?/m1/s1 |
| InChIKey | VDSDYVBOSXCLEC-MSRUFZRRSA-N |
| XLogP | 3.61 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|