C27H19NO5 — CID 27527953
methyl 2-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate (PubChem CID 27527953) has the molecular formula C27H19NO5 and a molecular weight of 437.45 g/mol. Its IUPAC name is methyl 2-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate.
| Compound Name | methyl 2-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate |
|---|---|
| PubChem CID | 27527953 |
| Molecular Formula | C27H19NO5 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | methyl 2-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)[C@@H]2C3c4ccccc4C(C=O)(c4ccccc43)[C@H]2C1=O |
| InChI | InChI=1S/C27H19NO5/c1-33-26(32)17-10-4-7-13-20(17)28-24(30)22-21-15-8-2-5-11-18(15)27(14-29,23(22)25(28)31)19-12-6-3-9-16(19)21/h2-14,21-23H,1H3/t21?,22-,23-,27?/m1/s1 |
| InChIKey | CDWMOKVIGZULOL-KWMZMRFFSA-N |
| XLogP | 3.22 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|