C20H15NO3 — CID 40553231
(15R,19S)-17-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde (PubChem CID 40553231) has the molecular formula C20H15NO3 and a molecular weight of 317.34 g/mol. Its IUPAC name is (15R,19S)-17-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde.
| Compound Name | (15R,19S)-17-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde |
|---|---|
| PubChem CID | 40553231 |
| Molecular Formula | C20H15NO3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (15R,19S)-17-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde |
| SMILES | CN1C(=O)[C@@H]2[C@@H](C1=O)C1c3ccccc3C2(C=O)c2ccccc21 |
| InChI | InChI=1S/C20H15NO3/c1-21-18(23)16-15-11-6-2-4-8-13(11)20(10-22,17(16)19(21)24)14-9-5-3-7-12(14)15/h2-10,15-17H,1H3/t15?,16-,17-,20?/m0/s1 |
| InChIKey | LLNPSEYXFKMOKA-ASPXRTSYSA-N |
| XLogP | 1.86 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|