C25H12F5NO3 — CID 3304262
16,18-dioxo-17-(2,3,4,5,6-pentafluorophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde (PubChem CID 3304262) has the molecular formula C25H12F5NO3 and a molecular weight of 469.37 g/mol. Its IUPAC name is 16,18-dioxo-17-(2,3,4,5,6-pentafluorophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde.
| Compound Name | 16,18-dioxo-17-(2,3,4,5,6-pentafluorophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde |
|---|---|
| PubChem CID | 3304262 |
| Molecular Formula | C25H12F5NO3 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 16,18-dioxo-17-(2,3,4,5,6-pentafluorophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde |
| SMILES | O=CC12c3ccccc3C(c3ccccc31)C1C(=O)N(c3c(F)c(F)c(F)c(F)c3F)C(=O)C12 |
| InChI | InChI=1S/C25H12F5NO3/c26-17-18(27)20(29)22(21(30)19(17)28)31-23(33)15-14-10-5-1-3-7-12(10)25(9-32,16(15)24(31)34)13-8-4-2-6-11(13)14/h1-9,14-16H |
| InChIKey | HMTVSBNZPLGRPG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|