C26H16NO5- — CID 11892257
3-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate (PubChem CID 11892257) has the molecular formula C26H16NO5- and a molecular weight of 422.42 g/mol. Its IUPAC name is 3-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate.
| Compound Name | 3-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate |
|---|---|
| PubChem CID | 11892257 |
| Molecular Formula | C26H16NO5- |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate |
| SMILES | O=CC12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(c3cccc(C(=O)[O-])c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C26H17NO5/c28-13-26-18-10-3-1-8-16(18)20(17-9-2-4-11-19(17)26)21-22(26)24(30)27(23(21)29)15-7-5-6-14(12-15)25(31)32/h1-13,20-22H,(H,31,32)/p-1/t20?,21-,22-,26?/m1/s1 |
| InChIKey | JKBQJTPECWCSMQ-OLJONYEBSA-M |
| XLogP | 1.80 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|