C27H18N2O7 — CID 126187605
[4-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-2-nitrophenyl] acetate (PubChem CID 126187605) has the molecular formula C27H18N2O7 and a molecular weight of 482.45 g/mol. Its IUPAC name is [4-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-2-nitrophenyl] acetate.
| Compound Name | [4-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-2-nitrophenyl] acetate |
|---|---|
| PubChem CID | 126187605 |
| Molecular Formula | C27H18N2O7 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | [4-[(15S,19R)-1-formyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-2-nitrophenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)[C@@H]3C4c5ccccc5C(C=O)(c5ccccc54)[C@H]3C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H18N2O7/c1-14(31)36-21-11-10-15(12-20(21)29(34)35)28-25(32)23-22-16-6-2-4-8-18(16)27(13-30,24(23)26(28)33)19-9-5-3-7-17(19)22/h2-13,22-24H,1H3/t22?,23-,24-,27?/m1/s1 |
| InChIKey | BCHDYARFDCIZRH-PGAZUGQPSA-N |
| XLogP | 3.27 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|