C25H16N2O5 — CID 5178376
17-(3-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde (PubChem CID 5178376) has the molecular formula C25H16N2O5 and a molecular weight of 424.41 g/mol. Its IUPAC name is 17-(3-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde.
| Compound Name | 17-(3-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde |
|---|---|
| PubChem CID | 5178376 |
| Molecular Formula | C25H16N2O5 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 17-(3-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carbaldehyde |
| SMILES | O=CC12c3ccccc3C(c3ccccc31)C1C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)C12 |
| InChI | InChI=1S/C25H16N2O5/c28-13-25-18-10-3-1-8-16(18)20(17-9-2-4-11-19(17)25)21-22(25)24(30)26(23(21)29)14-6-5-7-15(12-14)27(31)32/h1-13,20-22H |
| InChIKey | AYWYQHVEMOSEJA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|