C22H21NO3 — CID 46945308
(15R,19R)-1-[(1R)-1-methoxyethyl]-17-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 46945308) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is (15R,19R)-1-[(1R)-1-methoxyethyl]-17-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19R)-1-[(1R)-1-methoxyethyl]-17-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 46945308 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (15R,19R)-1-[(1R)-1-methoxyethyl]-17-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CO[C@H](C)C12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(C)C(=O)[C@H]12 |
| InChI | InChI=1S/C22H21NO3/c1-12(26-3)22-15-10-6-4-8-13(15)17(14-9-5-7-11-16(14)22)18-19(22)21(25)23(2)20(18)24/h4-12,17-19H,1-3H3/t12-,17?,18-,19+,22?/m1/s1 |
| InChIKey | SIHMVSWXXCVEGF-KDSMKTEKSA-N |
| XLogP | 2.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|