C23H23NO4 — CID 102214335
(15S,19S)-1-[(1R)-1,2-dimethoxyethyl]-17-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 102214335) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is (15S,19S)-1-[(1R)-1,2-dimethoxyethyl]-17-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19S)-1-[(1R)-1,2-dimethoxyethyl]-17-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 102214335 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (15S,19S)-1-[(1R)-1,2-dimethoxyethyl]-17-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | COC[C@H](OC)C12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C23H23NO4/c1-24-21(25)19-18-13-8-4-6-10-15(13)23(20(19)22(24)26,17(28-3)12-27-2)16-11-7-5-9-14(16)18/h4-11,17-20H,12H2,1-3H3/t17-,18?,19-,20+,23?/m0/s1 |
| InChIKey | KNXCRPYNHTUCIG-ZHRICRRYSA-N |
| XLogP | 2.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|