C23H23NO5 — CID 1035184
(15S,19S)-1-(dimethoxymethyl)-17-(2-hydroxyethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 1035184) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is (15S,19S)-1-(dimethoxymethyl)-17-(2-hydroxyethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19S)-1-(dimethoxymethyl)-17-(2-hydroxyethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 1035184 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (15S,19S)-1-(dimethoxymethyl)-17-(2-hydroxyethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | COC(OC)C12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(CCO)C(=O)[C@@H]12 |
| InChI | InChI=1S/C23H23NO5/c1-28-22(29-2)23-15-9-5-3-7-13(15)17(14-8-4-6-10-16(14)23)18-19(23)21(27)24(11-12-25)20(18)26/h3-10,17-19,22,25H,11-12H2,1-2H3/t17?,18-,19+,23?/m0/s1 |
| InChIKey | DMDFKQYCXNWYBH-SGIJDJSVSA-N |
| XLogP | 1.64 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|