C26H25NO2S — CID 53469547
(15R,18R,19R)-1-[(1R)-1-methoxyethyl]-17-methyl-18-thiophen-2-yl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-16-one (PubChem CID 53469547) has the molecular formula C26H25NO2S and a molecular weight of 415.56 g/mol. Its IUPAC name is (15R,18R,19R)-1-[(1R)-1-methoxyethyl]-17-methyl-18-thiophen-2-yl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-16-one.
| Compound Name | (15R,18R,19R)-1-[(1R)-1-methoxyethyl]-17-methyl-18-thiophen-2-yl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-16-one |
|---|---|
| PubChem CID | 53469547 |
| Molecular Formula | C26H25NO2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (15R,18R,19R)-1-[(1R)-1-methoxyethyl]-17-methyl-18-thiophen-2-yl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-16-one |
| SMILES | CO[C@H](C)C12c3ccccc3C(c3ccccc31)[C@@H]1[C@H]2C(=O)N(C)[C@H]1c1cccs1 |
| InChI | InChI=1S/C26H25NO2S/c1-15(29-3)26-18-11-6-4-9-16(18)21(17-10-5-7-12-19(17)26)22-23(26)25(28)27(2)24(22)20-13-8-14-30-20/h4-15,21-24H,1-3H3/t15-,21?,22-,23+,24+,26?/m1/s1 |
| InChIKey | JQPURZZYKYKSNC-HWHNDOISSA-N |
| XLogP | 4.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |