C25H27NO3 — CID 46945498
(15S,18S,19S)-18-hydroxy-1-[(1S)-1-methoxyethyl]-17-methyl-18-prop-2-enyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-16-one (PubChem CID 46945498) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (15S,18S,19S)-18-hydroxy-1-[(1S)-1-methoxyethyl]-17-methyl-18-prop-2-enyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-16-one.
| Compound Name | (15S,18S,19S)-18-hydroxy-1-[(1S)-1-methoxyethyl]-17-methyl-18-prop-2-enyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-16-one |
|---|---|
| PubChem CID | 46945498 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (15S,18S,19S)-18-hydroxy-1-[(1S)-1-methoxyethyl]-17-methyl-18-prop-2-enyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-16-one |
| SMILES | C=CC[C@]1(O)[C@H]2C3c4ccccc4C([C@H](C)OC)(c4ccccc43)[C@H]2C(=O)N1C |
| InChI | InChI=1S/C25H27NO3/c1-5-14-24(28)21-20-16-10-6-8-12-18(16)25(15(2)29-4,22(21)23(27)26(24)3)19-13-9-7-11-17(19)20/h5-13,15,20-22,28H,1,14H2,2-4H3/t15-,20?,21-,22+,24-,25?/m0/s1 |
| InChIKey | UPZBEKLNCJQAHV-QSXUERQRSA-N |
| XLogP | 3.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|