C32H30O4 — CID 101497592
(2S,6R,7S)-6-hydroxy-1-[(1S)-1-methoxyethyl]-6-[(E)-3-phenylprop-2-enoyl]pentacyclo[6.6.6.02,7.09,14.015,20]icosa-9,11,13,15,17,19-hexaen-3-one (PubChem CID 101497592) has the molecular formula C32H30O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is (2S,6R,7S)-6-hydroxy-1-[(1S)-1-methoxyethyl]-6-[(E)-3-phenylprop-2-enoyl]pentacyclo[6.6.6.02,7.09,14.015,20]icosa-9,11,13,15,17,19-hexaen-3-one.
| Compound Name | (2S,6R,7S)-6-hydroxy-1-[(1S)-1-methoxyethyl]-6-[(E)-3-phenylprop-2-enoyl]pentacyclo[6.6.6.02,7.09,14.015,20]icosa-9,11,13,15,17,19-hexaen-3-one |
|---|---|
| PubChem CID | 101497592 |
| Molecular Formula | C32H30O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (2S,6R,7S)-6-hydroxy-1-[(1S)-1-methoxyethyl]-6-[(E)-3-phenylprop-2-enoyl]pentacyclo[6.6.6.02,7.09,14.015,20]icosa-9,11,13,15,17,19-hexaen-3-one |
| SMILES | CO[C@@H](C)C12c3ccccc3C(c3ccccc31)[C@H]1[C@@H]2C(=O)CC[C@]1(O)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C32H30O4/c1-20(36-2)32-24-14-8-6-12-22(24)28(23-13-7-9-15-25(23)32)30-29(32)26(33)18-19-31(30,35)27(34)17-16-21-10-4-3-5-11-21/h3-17,20,28-30,35H,18-19H2,1-2H3/b17-16+/t20-,28?,29-,30-,31-,32?/m0/s1 |
| InChIKey | ONRCDTXLRVVMIA-QRFMLFDUSA-N |
| XLogP | 5.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|