C20H21NO2 — CID 5420874
(E)-N-[(1R)-1-[(1S)-3,4-dihydro-1H-isochromen-1-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 5420874) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (E)-N-[(1R)-1-[(1S)-3,4-dihydro-1H-isochromen-1-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-[(1S)-3,4-dihydro-1H-isochromen-1-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 5420874 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (E)-N-[(1R)-1-[(1S)-3,4-dihydro-1H-isochromen-1-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C=C/c1ccccc1)[C@H]1OCCc2ccccc21 |
| InChI | InChI=1S/C20H21NO2/c1-15(20-18-10-6-5-9-17(18)13-14-23-20)21-19(22)12-11-16-7-3-2-4-8-16/h2-12,15,20H,13-14H2,1H3,(H,21,22)/b12-11+/t15-,20-/m1/s1 |
| InChIKey | KBEHEPIHIKNOCU-NVBSGXMSSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|