C20H22N2O — CID 91552807
N-[1-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-3-phenylprop-2-enamide (PubChem CID 91552807) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-3-phenylprop-2-enamide.
| Compound Name | N-[1-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 91552807 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-[1-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-3-phenylprop-2-enamide |
| SMILES | CC(NC(=O)C=Cc1ccccc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H22N2O/c1-16(21-20(23)14-13-17-8-3-2-4-9-17)22-15-7-11-18-10-5-6-12-19(18)22/h2-6,8-10,12-14,16H,7,11,15H2,1H3,(H,21,23) |
| InChIKey | LWNREJIUPOUDMB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|