C21H22N2O2S — CID 86881495
(E)-N-[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]-3-(4-methylsulfanylphenyl)prop-2-enamide (PubChem CID 86881495) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is (E)-N-[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]-3-(4-methylsulfanylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]-3-(4-methylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 86881495 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (E)-N-[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]-3-(4-methylsulfanylphenyl)prop-2-enamide |
| SMILES | CSc1ccc(/C=C/C(=O)NC(C)C(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C21H22N2O2S/c1-15(21(25)23-14-13-17-5-3-4-6-19(17)23)22-20(24)12-9-16-7-10-18(26-2)11-8-16/h3-12,15H,13-14H2,1-2H3,(H,22,24)/b12-9+ |
| InChIKey | NFEOXKMUPSWGKV-FMIVXFBMSA-N |
| XLogP | 3.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|