C26H22N2O4 — CID 163146420
2-(1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-hydroxybenzeneamine oxide (PubChem CID 163146420) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-(1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-hydroxybenzeneamine oxide.
| Compound Name | 2-(1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163146420 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-(1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-hydroxybenzeneamine oxide |
| SMILES | O=C1C2C(c3ccccc3)C=CC(c3ccccc3)C2C(=O)N1c1ccccc1[NH+]([O-])O |
| InChI | InChI=1S/C26H22N2O4/c29-25-23-19(17-9-3-1-4-10-17)15-16-20(18-11-5-2-6-12-18)24(23)26(30)27(25)21-13-7-8-14-22(21)28(31)32/h1-16,19-20,23-24,28,31H |
| InChIKey | LTSDORQTTKJDRU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 85.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|