C24H16Br2N2O4 — CID 163177124
2-[(15R,19R)-1,8-dibromo-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163177124) has the molecular formula C24H16Br2N2O4 and a molecular weight of 556.21 g/mol. Its IUPAC name is 2-[(15R,19R)-1,8-dibromo-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[(15R,19R)-1,8-dibromo-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163177124 |
| Molecular Formula | C24H16Br2N2O4 |
| Molecular Weight | 556.21 g/mol |
| Exact Mass | 553.95 |
| IUPAC Name | 2-[(15R,19R)-1,8-dibromo-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-N-hydroxybenzeneamine oxide |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1c1ccccc1[NH+]([O-])O)C1(Br)c3ccccc3C2(Br)c2ccccc21 |
| InChI | InChI=1S/C24H16Br2N2O4/c25-23-13-7-1-2-8-14(13)24(26,16-10-4-3-9-15(16)23)20-19(23)21(29)27(22(20)30)17-11-5-6-12-18(17)28(31)32/h1-12,19-20,28,31H/t19-,20-,23?,24?/m1/s1 |
| InChIKey | XSFXBIUYEXPGSO-LMHXZZLNSA-N |
| XLogP | 3.50 |
| TPSA | 85.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|