C27H22N2O4 — CID 163136854
2-[(1R,2R,6S,7R)-3,5-dioxo-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163136854) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[(1R,2R,6S,7R)-3,5-dioxo-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[(1R,2R,6S,7R)-3,5-dioxo-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163136854 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-[(1R,2R,6S,7R)-3,5-dioxo-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-hydroxybenzeneamine oxide |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccccc1[NH+]([O-])O)[C@H]1C[C@H]2C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C27H22N2O4/c30-26-24-18-15-19(25(24)27(31)28(26)20-13-7-8-14-21(20)29(32)33)23(17-11-5-2-6-12-17)22(18)16-9-3-1-4-10-16/h1-14,18-19,24-25,29,32H,15H2/t18-,19-,24-,25+/m0/s1 |
| InChIKey | IGVUJXRBSXGFER-QXVOXHNYSA-N |
| XLogP | 3.46 |
| TPSA | 85.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|