C28H22BrNO2 — CID 71675588
4-(2-bromo-4-methylphenyl)-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 71675588) has the molecular formula C28H22BrNO2 and a molecular weight of 484.39 g/mol. Its IUPAC name is 4-(2-bromo-4-methylphenyl)-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-(2-bromo-4-methylphenyl)-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 71675588 |
| Molecular Formula | C28H22BrNO2 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 4-(2-bromo-4-methylphenyl)-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cc1ccc(N2C(=O)C3C4CC(C(c5ccccc5)=C4c4ccccc4)C3C2=O)c(Br)c1 |
| InChI | InChI=1S/C28H22BrNO2/c1-16-12-13-22(21(29)14-16)30-27(31)25-19-15-20(26(25)28(30)32)24(18-10-6-3-7-11-18)23(19)17-8-4-2-5-9-17/h2-14,19-20,25-26H,15H2,1H3 |
| InChIKey | UCDIISSXYGORFK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|