C28H24Br2N2O4 — CID 163123067
(2R,6S,8S,12R)-4,10-bis(2-bromo-4-methylphenyl)-1,14-dimethyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 163123067) has the molecular formula C28H24Br2N2O4 and a molecular weight of 612.32 g/mol. Its IUPAC name is (2R,6S,8S,12R)-4,10-bis(2-bromo-4-methylphenyl)-1,14-dimethyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | (2R,6S,8S,12R)-4,10-bis(2-bromo-4-methylphenyl)-1,14-dimethyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 163123067 |
| Molecular Formula | C28H24Br2N2O4 |
| Molecular Weight | 612.32 g/mol |
| Exact Mass | 610.01 |
| IUPAC Name | (2R,6S,8S,12R)-4,10-bis(2-bromo-4-methylphenyl)-1,14-dimethyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | CC1=CC2(C)[C@@H]3C(=O)N(c4ccc(C)cc4Br)C(=O)[C@H]3C1[C@@H]1C(=O)N(c3ccc(C)cc3Br)C(=O)[C@H]12 |
| InChI | InChI=1S/C28H24Br2N2O4/c1-12-5-7-17(15(29)9-12)31-24(33)20-19-14(3)11-28(4,22(20)26(31)35)23-21(19)25(34)32(27(23)36)18-8-6-13(2)10-16(18)30/h5-11,19-23H,1-4H3/t19?,20-,21-,22-,23-,28?/m0/s1 |
| InChIKey | CFIIFTBNIXIICJ-XFCQTPESSA-N |
| XLogP | 5.34 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.32 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|