C26H20Br2N2O4 — CID 11945249
(2R,6S,8R,12S)-4,10-bis(2-bromophenyl)-1,14-dimethyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 11945249) has the molecular formula C26H20Br2N2O4 and a molecular weight of 584.26 g/mol. Its IUPAC name is (2R,6S,8R,12S)-4,10-bis(2-bromophenyl)-1,14-dimethyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | (2R,6S,8R,12S)-4,10-bis(2-bromophenyl)-1,14-dimethyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 11945249 |
| Molecular Formula | C26H20Br2N2O4 |
| Molecular Weight | 584.26 g/mol |
| Exact Mass | 581.98 |
| IUPAC Name | (2R,6S,8R,12S)-4,10-bis(2-bromophenyl)-1,14-dimethyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | CC1=CC2(C)[C@@H]3C(=O)N(c4ccccc4Br)C(=O)[C@H]3C1[C@H]1C(=O)N(c3ccccc3Br)C(=O)[C@@H]12 |
| InChI | InChI=1S/C26H20Br2N2O4/c1-12-11-26(2)20-18(22(31)29(24(20)33)15-9-5-3-7-13(15)27)17(12)19-21(26)25(34)30(23(19)32)16-10-6-4-8-14(16)28/h3-11,17-21H,1-2H3/t17?,18-,19+,20-,21+,26? |
| InChIKey | CBOGQPVYJFYQAS-JRDNIAHHSA-N |
| XLogP | 4.72 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.26 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|