C28H20F6N2O6 — CID 97292252
(2S,6S,8R,12S)-1,14-dimethyl-4,10-bis[4-(trifluoromethoxy)phenyl]-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 97292252) has the molecular formula C28H20F6N2O6 and a molecular weight of 594.46 g/mol. Its IUPAC name is (2S,6S,8R,12S)-1,14-dimethyl-4,10-bis[4-(trifluoromethoxy)phenyl]-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | (2S,6S,8R,12S)-1,14-dimethyl-4,10-bis[4-(trifluoromethoxy)phenyl]-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 97292252 |
| Molecular Formula | C28H20F6N2O6 |
| Molecular Weight | 594.46 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | (2S,6S,8R,12S)-1,14-dimethyl-4,10-bis[4-(trifluoromethoxy)phenyl]-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | CC1=CC2(C)[C@H]3C(=O)N(c4ccc(OC(F)(F)F)cc4)C(=O)[C@@H]3C1[C@@H]1C(=O)N(c3ccc(OC(F)(F)F)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C28H20F6N2O6/c1-12-11-26(2)20-18(22(37)35(24(20)39)13-3-7-15(8-4-13)41-27(29,30)31)17(12)19-21(26)25(40)36(23(19)38)14-5-9-16(10-6-14)42-28(32,33)34/h3-11,17-21H,1-2H3/t17?,18-,19+,20-,21-,26?/m1/s1 |
| InChIKey | WTEFPNPOXRWSGL-CKIMKJIWSA-N |
| XLogP | 4.99 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|