C12H9F3N2O3S — CID 2822707
6-[4-(trifluoromethoxy)phenyl]-3,7a-dihydro-2H-imidazo[5,1-b][1,3]thiazole-5,7-dione (PubChem CID 2822707) has the molecular formula C12H9F3N2O3S and a molecular weight of 318.28 g/mol. Its IUPAC name is 6-[4-(trifluoromethoxy)phenyl]-3,7a-dihydro-2H-imidazo[5,1-b][1,3]thiazole-5,7-dione.
| Compound Name | 6-[4-(trifluoromethoxy)phenyl]-3,7a-dihydro-2H-imidazo[5,1-b][1,3]thiazole-5,7-dione |
|---|---|
| PubChem CID | 2822707 |
| Molecular Formula | C12H9F3N2O3S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 6-[4-(trifluoromethoxy)phenyl]-3,7a-dihydro-2H-imidazo[5,1-b][1,3]thiazole-5,7-dione |
| SMILES | O=C1C2SCCN2C(=O)N1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9F3N2O3S/c13-12(14,15)20-8-3-1-7(2-4-8)17-9(18)10-16(11(17)19)5-6-21-10/h1-4,10H,5-6H2 |
| InChIKey | RJNMSDBMAJZFNT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|