C13H11F3N2O3 — CID 115564979
7-[4-(trifluoromethoxy)phenyl]-5,7-diazaspiro[3.4]octane-6,8-dione (PubChem CID 115564979) has the molecular formula C13H11F3N2O3 and a molecular weight of 300.24 g/mol. Its IUPAC name is 7-[4-(trifluoromethoxy)phenyl]-5,7-diazaspiro[3.4]octane-6,8-dione.
| Compound Name | 7-[4-(trifluoromethoxy)phenyl]-5,7-diazaspiro[3.4]octane-6,8-dione |
|---|---|
| PubChem CID | 115564979 |
| Molecular Formula | C13H11F3N2O3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 7-[4-(trifluoromethoxy)phenyl]-5,7-diazaspiro[3.4]octane-6,8-dione |
| SMILES | O=C1NC2(CCC2)C(=O)N1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H11F3N2O3/c14-13(15,16)21-9-4-2-8(3-5-9)18-10(19)12(6-1-7-12)17-11(18)20/h2-5H,1,6-7H2,(H,17,20) |
| InChIKey | QHQGKCLJUPDJJX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|