C16H16F6N3O3+ — CID 7298512
(5R)-5-piperidin-1-ium-1-yl-3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)imidazolidine-2,4-dione (PubChem CID 7298512) has the molecular formula C16H16F6N3O3+ and a molecular weight of 412.31 g/mol. Its IUPAC name is (5R)-5-piperidin-1-ium-1-yl-3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-piperidin-1-ium-1-yl-3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7298512 |
| Molecular Formula | C16H16F6N3O3+ |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (5R)-5-piperidin-1-ium-1-yl-3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@]([NH+]2CCCCC2)(C(F)(F)F)C(=O)N1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F6N3O3/c17-15(18,19)14(24-8-2-1-3-9-24)12(26)25(13(27)23-14)10-4-6-11(7-5-10)28-16(20,21)22/h4-7H,1-3,8-9H2,(H,23,27)/p+1/t14-/m1/s1 |
| InChIKey | XXGQCTNAWBCHPM-CQSZACIVSA-O |
| XLogP | 1.97 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|